CAS 103430-01-9

5,7-Dimethoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one

Description:

5,7-Dimethoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one, with the CAS number 103430-01-9, is a synthetic organic compound belonging to the class of flavonoids, specifically a benzopyran derivative. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. The presence of methoxy groups at the 5 and 7 positions enhances its solubility and may influence its biological activity. The 3-methoxyphenyl substituent at the 2-position contributes to its structural complexity and potential pharmacological properties. Compounds of this nature are often studied for their antioxidant, anti-inflammatory, and anticancer activities, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with various biological targets, and its unique arrangement of functional groups may lead to diverse applications in pharmaceuticals and natural product chemistry. As with many flavonoids, it may also exhibit UV-absorbing properties, which can be relevant in formulations for cosmetic or therapeutic uses.

Formula: C₁₈H₁₆O₅

InChI: InChI=1S/C18H16O5/c1-20-12-6-4-5-11(7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3

InChI key: InChIKey=VXUYWDCUZZMTJC-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(OC(=CC2=O)C3=CC(OC)=CC=C3)=CC(OC)=C1

Synonyms:

• 5,7,3′-Trimethoxyflavone
• 4H-1-Benzopyran-4-one, 5,7-dimethoxy-2-(3-methoxyphenyl)-
• 5,7-Dimethoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one

5,7,3'-Trimethoxyflavone

CAS: 103430-01-9

5,7,3'-Trimethoxyflavone is a naturally occurring flavonoid compound, which is primarily sourced from certain plant species. As a member of the flavone category, this compound is characterized by its distinctive chemical structure featuring multiple methoxy groups. It is extracted from plants known for their medicinal properties, where it exists as a minor component contributing to the plant’s bioactive profile.

Formula: C₁₈H₁₆O₅

Purity: Min. 95%

Molecular weight: 312.32 g/mol

Ref: 3D-XT183034