CAS 103430-24-6
:QTX
Description:
QTX, with the CAS number 103430-24-6, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and agrochemicals. While detailed characteristics such as molecular structure, physical properties, and reactivity may vary, compounds like QTX typically exhibit unique functional groups that influence their behavior in chemical reactions. They may possess properties such as solubility in organic solvents, stability under certain conditions, and specific interactions with biological systems. The compound's safety profile, including toxicity and environmental impact, is also crucial for its handling and application. As with any chemical substance, proper safety measures should be observed when working with QTX, including the use of personal protective equipment and adherence to regulatory guidelines. For precise information regarding its characteristics, including its synthesis, applications, and safety data, consulting specialized literature or databases is recommended.
Formula:C21H26NO3S·Cl
InChI:InChI=1S/C21H26NO3S.ClH/c1-13-14(2)21-17(20(24)16-8-6-7-9-19(16)26-21)10-18(13)25-12-15(23)11-22(3,4)5;/h6-10,15,23H,11-12H2,1-5H3;1H/q+1;/p-1
InChI key:InChIKey=KLQWZWNTTNRVOZ-UHFFFAOYSA-M
SMILES:O=C1C=2C(SC=3C1=CC=CC3)=C(C)C(C)=C(OCC(C[N+](C)(C)C)O)C2.[Cl-]
Synonyms:- 1-Propanaminium, 3-[(3,4-dimethyl-9-oxo-9H-thioxanthen-2-yl)oxy]-2-hydroxy-N,N,N-trimethyl-, chloride
- 1-Propanaminium, 3-[(3,4-dimethyl-9-oxo-9H-thioxanthen-2-yl)oxy]-2-hydroxy-N,N,N-trimethyl-, chloride (1:1)
- 2-(3-Dimethylamino-2-hydroxypropoxy)-3,4-dimethyl-9H-thioxanthen-9-one methochloride
- 3-[(3,4-dimethyl-9-oxo-9H-thioxanthen-2-yl)oxy]-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride
- 9H-Thioxanthene, 1-propanaminium deriv.
- Kayacure QTX
- N-[2-Hydroxy-3-(3,4-dimethyl-9-oxo-9H-thioxanthen-2-yloxy)propyl]-N,N,N-trimethylammonium chloride
- Quantacure QTX
- Wb 4759
- [2-Hydroxy-3-(3,4-dimethyl-9-oxo-10-thiaanthracen-2-yloxy)propyl]trimethylammonium chloride
- [3-(3,4-Dimethyl-9-oxo-9H-thioxanthen-2-yloxy)-2-hydroxypropyl]trimethylammonium chloride
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quantacure QTX
CAS:Controlled ProductFormula:C21H26ClNO3SColor and Shape:NeatMolecular weight:333.425
