CAS 103438-88-6

2-Fluoro-3-methoxybenzaldehyde

Description:

2-Fluoro-3-methoxybenzaldehyde is an organic compound characterized by the presence of a fluorine atom, a methoxy group, and an aldehyde functional group attached to a benzene ring. Its molecular structure features a fluorine atom at the second position and a methoxy group (-OCH₃) at the third position relative to the aldehyde (-CHO) group, which is located at the first position. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the methoxy group can participate in various chemical reactions, enhancing the compound's versatility. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₈H₇FO₂

InChI: InChI=1/C8H7FO2/c1-11-7-4-2-3-6(5-10)8(7)9/h2-5H,1H3

SMILES: COc1cccc(C=O)c1F

2-Fluoro-3-methoxybenzaldehyde

CAS: 103438-88-6

Formula: C₈H₇FO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1384

Ref: IN-DA003H8T

2-Fluoro-3-methoxybenzaldehyde

CAS: 103438-88-6

2-Fluoro-3-methoxybenzaldehyde

Formula: C₈H₇FO₂

Purity: 99%

Color and Shape: light beige to light brown crystalline solid

Molecular weight: 154.14g/mol

Ref: 54-PC1746

2-Fluoro-3-methoxybenzaldehyde

CAS: 103438-88-6

Formula: C₈H₇FO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.14

Ref: 10-F049660