CAS 10344-42-0

4-bromo-3,6-dichloropyridazine

Description:

4-Bromo-3,6-dichloropyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which contains two nitrogen atoms in a six-membered aromatic structure. The presence of bromine and chlorine substituents at the 4 and 3,6 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown coloration. It is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of halogen atoms can enhance its reactivity, making it useful in various synthetic pathways. Additionally, 4-bromo-3,6-dichloropyridazine may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different chemical environments. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₄HBrCl₂N₂

InChI: InChI=1/C4HBrCl2N2/c5-2-1-3(6)8-9-4(2)7/h1H

SMILES: c1c(c(Cl)nnc1Cl)Br

Synonyms:

• Pyridazine, 4-Bromo-3,6-Dichloro-
• 4-Bromo-3,6-dichloropyridazine

4-Bromo-3,6-dichloropyridazine

CAS: 10344-42-0

Formula: C₄HBrCl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 227.8741

Ref: IN-DA00381M

4-Bromo-3,6-dichloropyridazine

CAS: 10344-42-0

4-Bromo-3,6-dichloropyridazine

Purity: 95%

Molecular weight: 227.88g/mol

Ref: 54-OR73358

4-Bromo-3,6-dichloropyridazine

CAS: 10344-42-0

Formula: C₄HBrCl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.87

Ref: 10-F227735