
CAS 103440-64-8
:4-(3-Butyn-1-yl)pyridine
Description:
4-(3-Butyn-1-yl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a butynyl substituent at the 4-position of the pyridine ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinct odor. The presence of the alkyne functional group (the butynyl chain) imparts reactivity, particularly in coupling reactions and other organic transformations. This compound is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. Its applications may include use as an intermediate in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the nitrogen atom in the pyridine ring can participate in coordination chemistry, making it a potential ligand for metal complexes. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H9N
InChI:InChI=1S/C9H9N/c1-2-3-4-9-5-7-10-8-6-9/h1,5-8H,3-4H2
InChI key:InChIKey=ZXWXCOLGKAUTAT-UHFFFAOYSA-N
SMILES:C(CC#C)C=1C=CN=CC1
Synonyms:- Pyridine, 4-(3-butynyl)-
- Pyridine, 4-(3-butyn-1-yl)-
- 4-(3-Butyn-1-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.