
CAS 103440-97-7
:3-Ethoxy-5-nitrobenzoic acid
Description:
3-Ethoxy-5-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a nitro group and an ethoxy substituent on a benzoic acid framework. The presence of the nitro group at the 5-position and the ethoxy group at the 3-position contributes to its unique chemical properties, including its reactivity and solubility characteristics. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring and the ethoxy group. The nitro group is known for its electron-withdrawing properties, which can influence the acidity of the carboxylic acid functional group, potentially making it a stronger acid compared to benzoic acid itself. 3-Ethoxy-5-nitrobenzoic acid may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c1-2-15-8-4-6(9(11)12)3-7(5-8)10(13)14/h3-5H,2H2,1H3,(H,11,12)
InChI key:InChIKey=FUESVFPKPIUSOD-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(C(O)=O)=CC(N(=O)=O)=C1
Synonyms:- Benzoic acid, 3-ethoxy-5-nitro-
- 3-Ethoxy-5-nitrobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.