CAS 103441-66-3

6-Amino-2,3-dihydro-4H-1-benzothiopyran-4-one

Description:

6-Amino-2,3-dihydro-4H-1-benzothiopyran-4-one is a heterocyclic organic compound characterized by its benzothiopyran structure, which incorporates a thiophene ring fused to a benzene ring. This compound features an amino group at the 6-position and a carbonyl group at the 4-position, contributing to its reactivity and potential biological activity. The presence of the dihydro configuration indicates that the compound has a saturated ring system, which can influence its physical properties, such as solubility and stability. It is typically a solid at room temperature and may exhibit moderate polarity due to the functional groups present. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar compounds have been explored for their antimicrobial and anti-inflammatory properties. Additionally, its CAS number, 103441-66-3, allows for easy identification and reference in chemical databases. Overall, this compound represents a class of molecules with diverse chemical behavior and potential therapeutic applications.

Formula: C₉H₉NOS

InChI: InChI=1S/C9H9NOS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4,10H2

InChI key: InChIKey=MQCVLBYIXAGLSX-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC=C(N)C2)SCC1

Synonyms:

• 6-Aminothiochroman-4-one
• 6-Amino-2,3-dihydro-4H-1-benzothiopyran-4-one
• Thiochroman-4-one, 6-amino-
• 4H-1-Benzothiopyran-4-one, 6-amino-2,3-dihydro-