CAS 103445-60-9
:2'-iodospiperone
Description:
2'-Iodospiperone is a chemical compound that belongs to the class of piperidine derivatives, characterized by the presence of an iodine atom at the 2' position of the piperone structure. It is primarily recognized for its role as a radioligand in neuroimaging studies, particularly in the investigation of dopamine receptors in the brain. The compound exhibits high affinity for dopamine D2 receptors, making it valuable in research related to psychiatric disorders and neuropharmacology. Its molecular structure includes a piperidine ring, a ketone functional group, and an iodine substituent, which contribute to its biological activity and receptor binding properties. 2'-Iodospiperone is typically utilized in the synthesis of radiolabeled versions for positron emission tomography (PET) imaging, aiding in the visualization of neurotransmitter systems. As with many iodine-containing compounds, it may exhibit specific handling and storage requirements due to its potential reactivity and the presence of halogen atoms. Overall, 2'-iodospiperone serves as an important tool in the field of medicinal chemistry and neuroscience research.
Formula:C23H25FIN3O2
InChI:InChI=1/C23H25FIN3O2/c24-17-8-9-19(20(25)15-17)21(29)7-4-12-27-13-10-23(11-14-27)22(30)26-16-28(23)18-5-2-1-3-6-18/h1-3,5-6,8-9,15H,4,7,10-14,16H2,(H,26,30)
SMILES:c1ccc(cc1)N1CN=C(C21CCN(CCCC(=O)c1ccc(cc1I)F)CC2)O
Synonyms:- 2'-Isp
- 1,3,8-Triazaspiro(4.5)decan-4-one, 8-(4-(4-fluoro-2-iodophenyl)-4-oxobutyl)-1-phenyl-
- 8-[4-(4-Fluoro-2-Iodophenyl)-4-Oxobutyl]-1-Phenyl-1,3,8-Triazaspiro[4.5]Decan-4-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.