CAS 1034457-07-2

1H-Indene-2-ethanamine, 2,3-dihydro-α,α-dimethyl-, hydrochloride (1:1)

Description:

1H-Indene-2-ethanamine, 2,3-dihydro-α,α-dimethyl-, hydrochloride (1:1), with CAS number 1034457-07-2, is a chemical compound characterized by its indene structure, which is a bicyclic compound featuring a five-membered ring fused to a six-membered ring. This compound contains an ethanamine functional group, indicating the presence of an amine (-NH2) attached to an ethyl chain. The α,α-dimethyl substitution suggests that there are two methyl groups attached to the carbon adjacent to the nitrogen atom, contributing to its steric properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, although specific pharmacological effects would require further investigation. Its stability, reactivity, and solubility characteristics make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₃H₁₉N·ClH

InChI: InChI=1S/C13H19N.ClH/c1-13(2,14)9-10-7-11-5-3-4-6-12(11)8-10;/h3-6,10H,7-9,14H2,1-2H3;1H

InChI key: InChIKey=WBROBVXHCOSKDW-UHFFFAOYSA-N

SMILES: C(C(C)(C)N)C1CC=2C(C1)=CC=CC2.Cl

Synonyms:

• 1H-Indene-2-ethanamine, 2,3-dihydro-α,α-dimethyl-, hydrochloride (1:1)

1-(2,3-Dihydro-1H-inden-2-yl)-2-methylpropan-2-amine hydrochloride

CAS: 1034457-07-2

1-(2,3-Dihydro-1H-inden-2-yl)-2-methylpropan-2-amine hydrochloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 225.76g/mol

Ref: 54-OR303019