CAS 103455-29-4
:3-methoxy-2-(2-styrylphenyl)propenic acid methyl ester
Description:
3-Methoxy-2-(2-styrylphenyl)propenic acid methyl ester, with the CAS number 103455-29-4, is an organic compound characterized by its complex structure that includes a methoxy group, a propenic acid moiety, and a styrylphenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. It is likely to be a yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of the methoxy group can enhance its solubility in organic solvents, while the styrylphenyl group may impart unique optical properties, making it of interest in fields such as materials science and organic synthesis. Additionally, the propenic acid structure suggests potential for further chemical modifications, including polymerization or functionalization reactions. Overall, this compound's unique structural features may lead to applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C19H18O3
InChI:InChI=1/C19H18O3/c1-21-14-18(19(20)22-2)17-11-7-6-10-16(17)13-12-15-8-4-3-5-9-15/h3-14H,1-2H3/b13-12+,18-14+
Synonyms:- beta-Methoxyacrylate stilbene
- Moa stilbene
- beta-Moa-stilbene
- Benzeneacetic acid, alpha-(methoxymethylene)-2-(2-phenylethenyl)-, methyl ester, (E,E)-
- methyl (2E)-3-methoxy-2-{2-[(E)-2-phenylethenyl]phenyl}prop-2-enoate
- 3-Methoxy-2-(2-styrylphenyl)propenic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MOA-stilbene
CAS:MOA-stilbene, a 3-Methoxy-2-(2-styrylphenyl)propenic acid ester, inhibits fluorescence & cytochrome complexes.Formula:C19H18O3Color and Shape:SolidMolecular weight:294.34
