CAS 1034566-07-8
:N-Methyl-1-phenyl-1H-imidazole-2-methanamine
Description:
N-Methyl-1-phenyl-1H-imidazole-2-methanamine, identified by its CAS number 1034566-07-8, is a chemical compound that belongs to the class of imidazole derivatives. This substance features a methyl group attached to the nitrogen atom of the imidazole ring and a phenyl group, contributing to its unique properties. It is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry. The compound typically exhibits moderate solubility in organic solvents, and its structure suggests it may participate in hydrogen bonding due to the presence of amine and imidazole functionalities. The presence of both a phenyl group and an imidazole ring may influence its lipophilicity and overall reactivity. As with many organic compounds, safety and handling precautions should be observed, as its specific toxicity and environmental impact would depend on its concentration and exposure routes. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-12-9-11-13-7-8-14(11)10-5-3-2-4-6-10/h2-8,12H,9H2,1H3
InChI key:InChIKey=IZYNHWOVGJNYQF-UHFFFAOYSA-N
SMILES:C(NC)C=1N(C=CN1)C2=CC=CC=C2
Synonyms:- 1H-Imidazole-2-methanamine, N-methyl-1-phenyl-
- N-Methyl-1-phenyl-1H-imidazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.