CymitQuimica logo

CAS 103460-89-5

:

1-cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

Description:
1-Cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with CAS number 103460-89-5, is a synthetic organic compound belonging to the class of quinolines. This compound features a bicyclic structure characterized by a quinoline core, which is further substituted with a cyclopropyl group and difluoro groups at specific positions. The presence of a carboxylic acid functional group contributes to its acidic properties, while the piperazine moiety enhances its potential for biological activity. The difluorination may influence its lipophilicity and metabolic stability. This compound has garnered interest in medicinal chemistry, particularly for its potential antimicrobial or antiviral properties, as many quinoline derivatives are known for their pharmacological activities. Its unique structural features may also affect its solubility, reactivity, and interaction with biological targets, making it a subject of research in drug development. However, specific physical and chemical properties such as melting point, solubility, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C18H19F2N3O3
InChI:InChI=1/C18H19F2N3O3/c1-9-7-22(5-4-21-9)16-13(19)6-11-15(14(16)20)23(10-2-3-10)8-12(17(11)24)18(25)26/h6,8-10,21H,2-5,7H2,1H3,(H,25,26)
InChI key:ZHKOPMSOBOQYRH-UHFFFAOYSA-N
SMILES:CC1CN(CCN1)c1c(cc2c(c1F)n(cc(c2=O)C(=O)O)C1CC1)F
Synonyms:
  • 1-Cyclopropyl-6,8-difluoro-7-(3-methylpiperazinyl)-4-oxohydroquinoline-3-carboxylic acid
Found 7 products.