CAS 103460-90-8
:1-cyclopropyl-7-(3,5-dimethylpiperazin-1-yl)-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Description:
1-Cyclopropyl-7-(3,5-dimethylpiperazin-1-yl)-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with CAS number 103460-90-8, is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a cyclopropyl group, and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry, particularly in the development of antimicrobial or antiviral agents. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the molecule. Additionally, the carboxylic acid functional group may contribute to its acidity and potential interactions with biological targets. The compound's unique structural features suggest it may interact with specific biological pathways, warranting further investigation into its pharmacological properties and therapeutic applications. Overall, this compound exemplifies the intricate design often employed in drug discovery to optimize efficacy and selectivity.
Formula:C19H21F2N3O3
InChI:InChI=1/C19H21F2N3O3/c1-9-6-23(7-10(2)22-9)17-14(20)5-12-16(15(17)21)24(11-3-4-11)8-13(18(12)25)19(26)27/h5,8-11,22H,3-4,6-7H2,1-2H3,(H,26,27)
InChI key:InChIKey=CMGSYIRPKZAEFD-UHFFFAOYSA-N
SMILES:FC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N3CC(C)NC(C)C3)C4CC4
Synonyms:- 1-Cyclopropyl-6,8-difluoro-7-(3,5-dimethylpiperazinyl)-4-oxohydroquinoline-3-carboxylic acid
- 1-Cyclopropyl-7-(3,5-dimethyl-1-piperazinyl)-6,8-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid
- 3-Quinolinecarboxylic acid, 1-cyclopropyl-7-(3,5-dimethyl-1-piperazinyl)-6,8-difluoro-1,4-dihydro-4-oxo-
- Amq 4
- Sparfloxacin Deamino impurity
- Valine Impurity 122
- 3-Quinolinecarboxylicacid,1-cyclopropyl-7-(3,5-dimethyl-1-piperazinyl)-6,8-difluoro-1,4-dihydro-4-oxo-
- Sparfloxacin Impurity 3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Cyclopropyl-7-(3,5-dimethyl-1-piperazinyl)-6,8-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid
CAS:Controlled ProductFormula:C19H21F2N3O3Color and Shape:NeatMolecular weight:377.385

