CAS 103466-44-0
:(9β,11β)-21-(Acetyloxy)-9,11-epoxypregna-1,4,16-triene-3,20-dione
Description:
The chemical substance known as "(9β,11β)-21-(Acetyloxy)-9,11-epoxypregna-1,4,16-triene-3,20-dione," with the CAS number 103466-44-0, is a synthetic steroid compound. It features a complex structure characterized by a steroid backbone, which includes multiple functional groups such as an epoxide and an acetoxy group. This compound is notable for its potential biological activity, particularly in the context of hormonal regulation and therapeutic applications. The presence of the epoxide moiety suggests reactivity that may influence its pharmacological properties. Additionally, the acetoxy group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. As a steroid derivative, it may interact with steroid receptors, influencing various physiological processes. Its specific applications and effects would depend on further studies, including its mechanism of action and efficacy in relevant biological systems. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function in steroid chemistry.
Formula:C23H26O5
InChI:InChI=1S/C23H26O5/c1-13(24)27-12-19(26)18-7-6-16-17-5-4-14-10-15(25)8-9-22(14,3)23(17)20(28-23)11-21(16,18)2/h7-10,16-17,20H,4-6,11-12H2,1-3H3/t16-,17-,20-,21-,22-,23+/m0/s1
InChI key:InChIKey=NYZZIRWUQLDQOR-GMNINMNUSA-N
SMILES:C[C@@]12[C@@]34[C@@](O3)(C[C@@]5(C)[C@]([C@@]4(CCC1=CC(=O)C=C2)[H])(CC=C5C(COC(C)=O)=O)[H])[H]
Synonyms:- Pregna-1,4,16-triene-3,20-dione, 21-(acetyloxy)-9,11-epoxy-, (9β,11β)-
- (9β,11β)-21-(Acetyloxy)-9,11-epoxypregna-1,4,16-triene-3,20-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(9b,11b)-21-(Acetyloxy)-9,11-epoxypregna-1,4,16-triene-3,20-dione
CAS:Controlled Product<p>Applications (9β,11β)-21-(Acetyloxy)-9,11-epoxypregna-1,4,16-triene-3,20-dione is an intermediate in synthesizing 14,15-Dehydro Triamcinolone Acetonide (D230570), a derivative of Triamcinolone Acetonide. A corticosteroid.<br></p>Formula:C23H26O5Color and Shape:NeatMolecular weight:382.46
