
CAS 10347-14-5
:1,2,4-Benzenetricarbonitrile
Description:
1,2,4-Benzenetricarbonitrile, also known as benzene-1,2,4-tricarbonitrile, is an organic compound characterized by the presence of three cyano groups (-C≡N) attached to a benzene ring at the 1, 2, and 4 positions. This compound is a colorless to pale yellow solid at room temperature and is known for its high melting point and low solubility in water, making it more soluble in organic solvents. The presence of multiple cyano groups contributes to its strong electron-withdrawing properties, which can influence its reactivity and interactions with other chemical species. 1,2,4-Benzenetricarbonitrile is often used in organic synthesis and materials science, particularly in the development of polymers and as a precursor for various chemical reactions. Its unique structure allows for potential applications in the fields of pharmaceuticals and agrochemicals, where cyano groups can serve as functional handles for further chemical modifications. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H3N3
InChI:InChI=1S/C9H3N3/c10-4-7-1-2-8(5-11)9(3-7)6-12/h1-3H
InChI key:InChIKey=RTJRHFSBKHHQEI-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C#N)C=CC(C#N)=C1
Synonyms:- 1,2,5-Benzenetricarbonitrile
- 1,2,4-Benzenetrinitrile
- Trimellitonitrile
- 1,2,4-Benzenetricarbonitrile
- 1,2,4-Tricyanobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.