
CAS 1034734-65-0
:4-(2-Methyl-2H-tetrazol-5-yl)-1,2-benzenediol
Description:
4-(2-Methyl-2H-tetrazol-5-yl)-1,2-benzenediol, identified by its CAS number 1034734-65-0, is a chemical compound that features a tetrazole ring and a dihydroxybenzene structure. This compound is characterized by its unique combination of functional groups, which includes a tetrazole moiety that contributes to its potential biological activity and solubility properties. The presence of hydroxyl groups on the benzene ring enhances its reactivity and ability to form hydrogen bonds, making it a candidate for various chemical reactions and applications in medicinal chemistry. The methyl group on the tetrazole ring may influence its lipophilicity and overall stability. Additionally, compounds with tetrazole structures are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. Overall, this compound's structural features suggest potential utility in drug development and other chemical applications, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C8H8N4O2
InChI:InChI=1S/C8H8N4O2/c1-12-10-8(9-11-12)5-2-3-6(13)7(14)4-5/h2-4,13-14H,1H3
InChI key:InChIKey=KWOMBEZUYJKPHE-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1O)C2=NN(C)N=N2
Synonyms:- 4-(2-Methyl-2H-tetrazol-5-yl)-1,2-benzenediol
- 1,2-Benzenediol, 4-(2-methyl-2H-tetrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.