CAS 103478-23-5
:Bicyclo[3.1.0]hexane-1,5-dimethanol
Description:
Bicyclo[3.1.0]hexane-1,5-dimethanol is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclohexane framework with two hydroxymethyl (-CH2OH) groups located at the 1 and 5 positions. This compound exhibits properties typical of alcohols, including the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The presence of the hydroxymethyl groups also contributes to its reactivity, making it a potential candidate for further chemical modifications or applications in synthesis. The bicyclic structure imparts rigidity to the molecule, which can affect its physical properties, such as boiling and melting points, compared to more flexible aliphatic alcohols. Additionally, the compound may exhibit interesting stereochemical properties due to the spatial arrangement of its substituents. Overall, Bicyclo[3.1.0]hexane-1,5-dimethanol is of interest in organic chemistry for its structural uniqueness and potential applications in various chemical reactions and material science.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c9-5-7-2-1-3-8(7,4-7)6-10/h9-10H,1-6H2
InChI key:InChIKey=CGMPNPMESSHFNO-UHFFFAOYSA-N
SMILES:C(O)C12C(CO)(C1)CCC2
Synonyms:- Bicyclo[3.1.0]hexane-1,5-dimethanol
- [5-(Hydroxymethyl)bicyclo[3.1.0]hexan-1-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.