CymitQuimica logo

CAS 10349-08-3

:

3-(4-Chlorophenyl)-1,2,5-oxadiazole

Description:
3-(4-Chlorophenyl)-1,2,5-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. The presence of the 4-chlorophenyl group enhances its chemical properties, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high stability under standard conditions, and its solubility can vary depending on the solvent used. It may display biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. The compound's molecular structure allows for potential interactions with biological targets, which can be explored through further research. Additionally, its unique electronic properties, influenced by the chlorophenyl substituent, may lead to interesting photophysical behaviors. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-7-3-1-6(2-4-7)8-5-10-12-11-8/h1-5H
InChI key:InChIKey=PFQKBMUSFZCBOO-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=C1)C=2C=NON2
Synonyms:
  • 3-(4-Chlorophenyl)-1,2,5-oxadiazole
  • 1,2,5-Oxadiazole, 3-(4-chlorophenyl)-
  • Furazan, (4-chlorophenyl)-
  • Furazan, (p-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.