CymitQuimica logo

CAS 1034975-35-3

:

tert-butyl 2-amino-4-(4-methylpiperazin-1-yl) benzoate

Description:
Tert-butyl 2-amino-4-(4-methylpiperazin-1-yl) benzoate is a chemical compound characterized by its complex structure, which includes a benzoate moiety, an amino group, and a piperazine ring. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the amino group. The tert-butyl group contributes to its hydrophobic characteristics, influencing its overall solubility and reactivity. The piperazine ring can impart biological activity, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in drug design, where modifications can enhance selectivity and efficacy. Additionally, the presence of multiple functional groups may allow for diverse chemical reactivity, making it a versatile building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H25N3O2
InChI:InChI=1S/C16H25N3O2/c1-16(2,3)21-15(20)13-6-5-12(11-14(13)17)19-9-7-18(4)8-10-19/h5-6,11H,7-10,17H2,1-4H3
InChI key:DIFVPEGUJIXKOC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1=C(C=C(C=C1)N2CCN(CC2)C)N
Found 3 products.