CAS 1035-19-4
:2-(phenylsulfonyl)-1,2-dihydroisoquinoline-1-carbonitrile
Description:
2-(Phenylsulfonyl)-1,2-dihydroisoquinoline-1-carbonitrile, with the CAS number 1035-19-4, is a chemical compound characterized by its complex structure, which includes a dihydroisoquinoline core, a phenylsulfonyl group, and a carbonitrile functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the sulfonyl group can enhance solubility and reactivity, making it useful in synthetic organic chemistry. Additionally, the carbonitrile group may contribute to the compound's polarity and reactivity, allowing for potential applications in medicinal chemistry and material science. The compound's unique structure suggests it may interact with biological targets, which could be of interest in drug development. Overall, 2-(phenylsulfonyl)-1,2-dihydroisoquinoline-1-carbonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C16H12N2O2S
InChI:InChI=1/C16H12N2O2S/c17-12-16-15-9-5-4-6-13(15)10-11-18(16)21(19,20)14-7-2-1-3-8-14/h1-11,16H
SMILES:c1ccc(cc1)S(=O)(=O)N1C=Cc2ccccc2C1C#N
Synonyms:- 2-(benzenesulfonyl)-1H-isoquinoline-1-carbonitrile
- 1-CYANO-1,2-DIHYDRO-2-(PHENYLSULFONYL)ISOQUINOLINE
- 1-Isoquinolinecarbonitrile,1,2-dihydro-2-(phenylsulfonyl)-
- 2-(Benzenesulfonyl)-1,2-dihydroisoquinoline-1-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.