CAS 103500-23-8

Phenylmethyl N-(1-formylcyclopropyl)carbamate

Description:

Phenylmethyl N-(1-formylcyclopropyl)carbamate, identified by its CAS number 103500-23-8, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl (C=O) linked to a nitrogen atom (N) that is also bonded to an alkyl or aryl group. This compound includes a phenylmethyl group, indicating the presence of a phenyl ring attached to a methyl group, and a cyclopropyl moiety that is substituted with a formyl group (–CHO). The structural characteristics suggest that it may exhibit unique reactivity and potential applications in organic synthesis or medicinal chemistry. The presence of the cyclopropyl ring can impart strain, influencing the compound's stability and reactivity. Additionally, the carbamate group is known for its role in various biological activities, making this compound of interest for further research in pharmacology or agrochemicals. As with many organic compounds, its physical properties such as solubility, melting point, and boiling point would depend on the specific molecular interactions and the environment in which it is studied.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c14-9-12(6-7-12)13-11(15)16-8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,13,15)

InChI key: InChIKey=VQLUEONQFAZVQG-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2(C=O)CC2

Synonyms:

• Carbamic acid, (1-formylcyclopropyl)-, phenylmethyl ester
• Phenylmethyl N-(1-formylcyclopropyl)carbamate
• Carbamic acid, N-(1-formylcyclopropyl)-, phenylmethyl ester
• Benzyl (1-formylcyclopropyl)carbamate