CAS 10351-75-4
:Benzimidazole-5,6-dicarboxylic acid
Description:
Benzimidazole-5,6-dicarboxylic acid is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. This compound features two carboxylic acid groups (-COOH) located at the 5 and 6 positions of the benzimidazole ring, contributing to its acidic properties and enhancing its solubility in polar solvents. It is typically a white to off-white crystalline solid and is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The presence of the carboxylic acid groups allows for various chemical modifications, making it versatile in synthetic chemistry. Additionally, benzimidazole derivatives are often studied for their biological activities, including antimicrobial and anticancer properties. The compound's molecular structure and functional groups play a crucial role in its reactivity and interactions with other molecules, making it an interesting subject for research in medicinal chemistry and materials science.
Formula:C9H6N2O4
InChI:InChI=1/C9H6N2O4/c12-8(13)4-1-6-7(11-3-10-6)2-5(4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)
SMILES:c1c(c(cc2c1nc[nH]2)C(=O)O)C(=O)O
Synonyms:- 1H-benzimidazole-5,6-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzimidazole-5,6-dicarboxylic acid, 97%
CAS:Benzimidazole-5,6-dicarboxylic acid is a important organic intermediate. It is used in agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the leFormula:C9H6N2O4Purity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:206.161H-Benzo[d]imidazole-5,6-dicarboxylic acid
CAS:Formula:C9H6N2O4Purity:97%Color and Shape:SolidMolecular weight:206.15491H-Benzo[d]imidazole-5,6-dicarboxylic acid
CAS:1H-Benzo[d]imidazole-5,6-dicarboxylic acidPurity:98%Molecular weight:206.15g/mol1H-Benzo[d]imidazole-5,6-dicarboxylic acid
CAS:Formula:C9H6N2O4Purity:95%Color and Shape:SolidMolecular weight:206.157



