CymitQuimica logo

CAS 103514-53-0

:

3-Quinolinecarboxylic acid, 4-hydroxy-6-nitro-, ethyl ester

Description:
3-Quinolinecarboxylic acid, 4-hydroxy-6-nitro-, ethyl ester, identified by its CAS number 103514-53-0, is an organic compound that belongs to the class of quinoline derivatives. This compound features a quinoline ring system, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a carboxylic acid group and an ethyl ester functional group indicates that it can participate in various chemical reactions, such as esterification and hydrolysis. The hydroxy and nitro substituents on the quinoline ring contribute to its chemical reactivity and potential biological activity. This compound may exhibit properties such as antimicrobial or anti-inflammatory effects, making it of interest in pharmaceutical research. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 3-Quinolinecarboxylic acid, 4-hydroxy-6-nitro-, ethyl ester is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C12H10N2O5
InChI:InChI=1S/C12H10N2O5/c1-2-19-12(16)9-6-13-10-4-3-7(14(17)18)5-8(10)11(9)15/h3-6H,2H2,1H3,(H,13,15)
InChI key:DBJCDCSZGDONQQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)[N+](=O)[O-]
Found 3 products.