CAS 10352-88-2
:trans-2-Heptenoic acid
Description:
Trans-2-heptenoic acid is an unsaturated fatty acid characterized by a double bond between the second and third carbon atoms in its chain, which is in the trans configuration. This structural feature influences its physical and chemical properties, including its melting and boiling points, which are typically lower than those of saturated fatty acids of similar chain length. The molecule has a seven-carbon backbone, making it a medium-chain fatty acid. It is a colorless to pale yellow liquid with a characteristic odor. Trans-2-heptenoic acid is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. It can participate in various chemical reactions typical of carboxylic acids, such as esterification and hydrogenation. This compound is of interest in organic synthesis and may be used in the production of various esters and other derivatives. Additionally, its trans configuration can affect its biological activity and interactions in biochemical processes.
Formula:C7H12O2
InChI:InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+
InChI key:InChIKey=YURNCBVQZBJDAJ-AATRIKPKSA-N
SMILES:C(=C/C(O)=O)\CCCC
Synonyms:- (2E)-hept-2-enoic acid
- (2E)-2-Heptenoic acid
- E-2-Heptenoic acid
- trans-2-Heptenoic acid
- hept-2-enoate
- 2-Heptenoic acid, (2E)-
- 2-Heptenoic acid, (E)-
- Heptenoicacidtech
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.