CymitQuimica logo

CAS 1035261-84-7

:

Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid

Description:
Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid is a chemical compound characterized by its unique molecular structure, which includes a tetrahydropyran ring and a trifluoromethyl-substituted phenyl group. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, which can improve the pharmacokinetic properties of the molecule. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters, which can further modify its biological activity. The compound's structural features may also influence its solubility and reactivity, making it a subject of interest in synthetic organic chemistry. Overall, Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid exemplifies the complexity and versatility of modern organic compounds in drug design and development.
Formula:C13H13F3O3
InChI:InChI=1S/C13H13F3O3/c14-13(15,16)10-3-1-2-9(8-10)12(11(17)18)4-6-19-7-5-12/h1-3,8H,4-7H2,(H,17,18)
InChI key:InChIKey=CKZJJQRWWKDAHA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCOCC1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid
  • 2H-Pyran-4-carboxylic acid, tetrahydro-4-[3-(trifluoromethyl)phenyl]-
  • 4-[3-(Trifluoromethyl)phenyl]tetrahydro-2H-pyran-4-carboxylic acid
Found 3 products.