CAS 1035262-12-4

4-(3,4-Difluorophenyl)tetrahydro-2H-pyran-4-carboxylic acid

Description:

4-(3,4-Difluorophenyl)tetrahydro-2H-pyran-4-carboxylic acid is an organic compound characterized by its unique structure, which includes a tetrahydropyran ring and a carboxylic acid functional group. The presence of the 3,4-difluorophenyl substituent contributes to its chemical properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the carboxylic acid group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The difluorophenyl group may impart specific electronic characteristics, affecting its interaction with biological targets or other chemical species. Additionally, the compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific biological activities. As with many organic compounds, safety and handling precautions should be observed, given the potential reactivity of the functional groups present.

Formula: C₁₂H₁₂F₂O₃

InChI: InChI=1S/C12H12F2O3/c13-9-2-1-8(7-10(9)14)12(11(15)16)3-5-17-6-4-12/h1-2,7H,3-6H2,(H,15,16)

InChI key: InChIKey=RUSOUAOZFJTCNJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CCOCC1)C2=CC(F)=C(F)C=C2

Synonyms:

• 4-(3,4-Difluorophenyl)tetrahydro-2H-pyran-4-carboxylic acid
• 2H-Pyran-4-carboxylic acid, 4-(3,4-difluorophenyl)tetrahydro-