CymitQuimica logo

CAS 1035264-55-1

:

2-Fluoro-4-(4-piperidinyl)benzonitrile

Description:
2-Fluoro-4-(4-piperidinyl)benzonitrile is a chemical compound characterized by its structural features, which include a fluorine atom and a piperidine ring attached to a benzonitrile moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The piperidine group, a six-membered ring containing one nitrogen atom, is known for its role in various pharmacological applications, often contributing to the compound's ability to interact with biological targets. This compound may exhibit properties such as moderate to high solubility in organic solvents, and its nitrile functional group can participate in various chemical reactions, including nucleophilic additions. Additionally, the compound's potential applications may span across medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 2-Fluoro-4-(4-piperidinyl)benzonitrile represents a versatile structure in the realm of chemical research and development.
Formula:C12H13FN2
InChI:InChI=1S/C12H13FN2/c13-12-7-10(1-2-11(12)8-14)9-3-5-15-6-4-9/h1-2,7,9,15H,3-6H2
InChI key:InChIKey=JMVDBGDWWYQUJG-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C#N)C2CCNCC2
Synonyms:
  • 2-Fluoro-4-(4-piperidinyl)benzonitrile
  • 2-Fluoro-4-piperidin-4-yl-cyanobenzene
  • Benzonitrile, 2-fluoro-4-(4-piperidinyl)-
  • 2-Fluoro-4-(piperidin-4-yl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.