CAS 1035271-44-3

1H-Pyrrolo[3,4-b]pyridine, octahydro-, hydrochloride (1:2)

Description:

1H-Pyrrolo[3,4-b]pyridine, octahydro-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a pyrrole and a pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The octahydro designation indicates that the compound is fully saturated, contributing to its stability and potentially influencing its reactivity and biological activity. It may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. The hydrochloride form enhances its solubility and bioavailability, which is crucial for therapeutic applications. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1S/C7H14N2.2ClH/c1-2-6-4-8-5-7(6)9-3-1;;/h6-9H,1-5H2;2*1H

InChI key: InChIKey=PBDBVGLZVIIZNU-UHFFFAOYSA-N

SMILES: C12C(CNC1)NCCC2.Cl

Synonyms:

• 2,3,4,4a,5,6,7,7a-Octahydro-1H-pyrrolo[3,4-b]pyridine dihydrochloride
• 1H-Pyrrolo[3,4-b]pyridine, octahydro-, hydrochloride (1:2)