CAS 103528-50-3
:kibdelin A
Description:
Kibdelin A is a natural product classified as a polyketide, originally isolated from the fermentation broth of the actinobacterium Kibdelosporangium sp. It exhibits a complex molecular structure characterized by multiple functional groups, including a lactone ring and various stereocenters, contributing to its biological activity. Kibdelin A has garnered interest in the field of medicinal chemistry due to its reported antimicrobial and cytotoxic properties, making it a candidate for further pharmacological studies. Its mechanism of action and potential therapeutic applications are subjects of ongoing research, particularly in the context of drug development against resistant bacterial strains and cancer cells. The compound's unique structural features and biological activities highlight the importance of natural products in discovering new therapeutic agents. As with many natural compounds, the extraction and purification processes can be challenging, necessitating advanced techniques to obtain sufficient quantities for research and potential clinical applications.
Formula:C81H84Cl4N8O29
InChI:InChI=1/C81H84Cl4N8O29/c1-3-4-5-6-7-8-9-10-53(100)87-78-68(106)65(103)40(28-94)80(122-78)121-71-50-22-33-23-51(71)118-70-42(83)19-34(20-43(70)84)64(102)62-77(113)91-60(79(114)115)38-24-35(96)25-49(119-81-69(107)67(105)66(104)52(29-95)120-81)54(38)37-17-30(11-14-44(37)97)57(73(109)93-62)88-74(110)58(33)89-75(111)59-39-26-36(27-46(99)55(39)85)116-48-21-31(12-15-45(48)98)56(86-2)72(108)92-61(76(112)90-59)63(101)32-13-16-47(117-50)41(82)18-32/h11-27,40,52,56-69,78,80-81,86,94-99,101-107H,3-10,28-29H2,1-2H3,(H,87,100)(H,88,110)(H,89,111)(H,90,112)(H,91,113)(H,92,108)(H,93,109)(H,114,115)
Synonyms:- Ristomycin A aglycone, 5,22,31,55-tetrachloro-7-demethyl-64-O-demethyl-56-O-(2-deoxy-2-((1-oxodecyl)amino)-beta-D-glucopyranosyl)-42-O-alpha-D-mannopyranosyl-N15-methyl-
- Kibdelin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Kibdelin A
CAS:<p>Kibdelin A is effective against Gram-positive bacteria and exhibits effects similar to Vancomycin against Staphylococcus aureus (including methicillin-resistant strains).</p>Formula:C81H84Cl4N8O29Color and Shape:SolidMolecular weight:1775.38
