CAS 10353-59-0

3-Fluoro-2-methylpropanenitrile

Description:

3-Fluoro-2-methylpropanenitrile, with the CAS number 10353-59-0, is an organic compound characterized by the presence of a nitrile functional group (-C≡N) and a fluorine atom attached to a branched carbon chain. This compound features a three-carbon backbone with a methyl group and a fluorine substituent at the second and third positions, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the nitrile group imparts notable polarity and potential reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the fluorine atom can enhance the compound's stability and lipophilicity, influencing its behavior in biological systems. As with many nitriles, it may exhibit moderate toxicity and should be handled with care in laboratory settings. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance.

Formula: C₄H₆FN

InChI: InChI=1S/C4H6FN/c1-4(2-5)3-6/h4H,2H2,1H3

InChI key: InChIKey=CHDFZIOVBJFWBU-UHFFFAOYSA-N

SMILES: C(CF)(C#N)C

Synonyms:

• Propanenitrile, 3-fluoro-2-methyl-
• 3-Fluoro-2-methylpropanenitrile