CAS 1035325-24-6

rel-(1R,3R)-3-[[(Phenylmethoxy)carbonyl]amino]cyclohexanecarboxylic acid

Description:

Rel-(1R,3R)-3-[[(Phenylmethoxy)carbonyl]amino]cyclohexanecarboxylic acid, with CAS number 1035325-24-6, is a chiral compound characterized by its cyclohexane ring structure, which contributes to its stereochemistry. The presence of the phenylmethoxycarbonyl group indicates that it has an aromatic component, enhancing its potential for interactions in biological systems. This compound is likely to exhibit properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions due to its carboxylic acid and amine functional groups. Its stereochemistry (1R,3R) suggests specific spatial arrangements that can influence its biological activity and interactions with enzymes or receptors. The compound may be of interest in pharmaceutical applications, particularly in drug design, due to its potential to mimic natural amino acids or peptides. Additionally, its solubility and stability in various solvents can be influenced by the substituents on the cyclohexane ring and the presence of the phenyl group.

Formula: C₁₅H₁₉NO₄

InChI: InChI=1/C15H19NO4/c17-14(18)12-7-4-8-13(9-12)16-15(19)20-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H,16,19)(H,17,18)/t12-,13-/s2

InChI key: InChIKey=LTEORMGXUMWZCU-NVHKGDCHNA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)[C@H]2C[C@H](C(O)=O)CCC2

Synonyms:

• trans-3-(((Benzyloxy)carbonyl)amino)cyclohexanecarboxylic acid
• rel-(1R,3R)-3-[[(Phenylmethoxy)carbonyl]amino]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 3-[[(phenylmethoxy)carbonyl]amino]-, (1R,3R)-rel-