CymitQuimica logo

CAS 1035351-08-6

:

3-Hydroxy-3-azetidineethanol

Description:
3-Hydroxy-3-azetidineethanol, identified by its CAS number 1035351-08-6, is a chemical compound characterized by the presence of a hydroxyl group (-OH) and an azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. This compound is typically classified as an amino alcohol due to the presence of both an amine and an alcohol functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the azetidine ring can contribute to biological activity and molecular interactions. The hydroxyl group enhances solubility in polar solvents and may participate in hydrogen bonding, influencing the compound's reactivity and stability. Additionally, the presence of the nitrogen atom in the azetidine ring can impart basic properties, making it a potential ligand in coordination chemistry. Overall, 3-Hydroxy-3-azetidineethanol exhibits unique structural features that may be leveraged in various chemical and biological applications.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c7-2-1-5(8)3-6-4-5/h6-8H,1-4H2
InChI key:InChIKey=CGQWJGGKTXCEKJ-UHFFFAOYSA-N
SMILES:C(CO)C1(O)CNC1
Synonyms:
  • 3-Azetidineethanol, 3-hydroxy-
  • 3-Hydroxy-3-azetidineethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.