CAS 103539-32-8: METHYL (R)-AZIRIDINE-2-CARBOXYLATE
Description:Methyl (R)-aziridine-2-carboxylate is a chiral compound characterized by its aziridine ring, which is a three-membered cyclic amine. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The (R) configuration indicates the specific spatial arrangement of its substituents, which is crucial for its biological activity and interaction with other chiral compounds. Methyl (R)-aziridine-2-carboxylate is often utilized in the pharmaceutical industry for the development of drugs, as well as in the production of agrochemicals. Its unique structure allows for the introduction of diverse functional groups, facilitating the creation of novel compounds with desired properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C4H7NO2
InChI:InChI=1/C4H7NO2/c1-7-4(6)3-2-5-3/h3,5H,2H2,1H3/t3-/m1/s1
- Synonyms:
- 2-Aziridinecarboxylic acid, methyl ester, (2R)-
- Methyl (2R)-aziridine-2-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl (R)-aziridine-2-carboxylate REF: 54-OR313079CAS: 103539-32-8 | 95% | To inquire | Wed 26 Mar 25 |
![]() | Methyl (R)-aziridine-2-carboxylate REF: 10-F040007CAS: 103539-32-8 | 97.0% | - - - | Discontinued product |
![]() | Methyl (R)-aziridine-2-carboxylate REF: 3D-DEA53932CAS: 103539-32-8 | Min. 95% | - - - | Discontinued product |

Methyl (R)-aziridine-2-carboxylate
Ref: 54-OR313079
Undefined size | To inquire |

Methyl (R)-aziridine-2-carboxylate
Ref: 10-F040007
2.5g | Discontinued | Request information |

Methyl (R)-aziridine-2-carboxylate
Ref: 3D-DEA53932
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information |