
CAS 10354-58-2
:N-Butyl-4-pyridinecarboxamide
Description:
N-Butyl-4-pyridinecarboxamide, with the CAS number 10354-58-2, is an organic compound characterized by its pyridine ring structure substituted with a butyl group and a carboxamide functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the carboxamide group, which can engage in hydrogen bonding. N-Butyl-4-pyridinecarboxamide is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may act as a building block or intermediate in the synthesis of more complex molecules. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and specific formulations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-2-3-6-12-10(13)9-4-7-11-8-5-9/h4-5,7-8H,2-3,6H2,1H3,(H,12,13)
InChI key:InChIKey=IDNGPRYAMMACEI-UHFFFAOYSA-N
SMILES:C(NCCCC)(=O)C=1C=CN=CC1
Synonyms:- N-Butyl-4-pyridinecarboxamide
- Isonicotinamide, N-butyl-
- 4-Pyridinecarboxamide, N-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.