CAS 1035438-80-2
:P,P′-[1-Hydroxy-2-(3-pyridinyl-2,4,5,6-d4)ethylidene]bis[phosphonic acid]
Description:
P,P′-[1-Hydroxy-2-(3-pyridinyl-2,4,5,6-d4)ethylidene]bis[phosphonic acid] is a chemical compound characterized by its phosphonic acid functional groups, which are known for their ability to form strong bonds with metal ions and biological molecules. This compound features a hydroxy group and a pyridine ring, which contribute to its potential biological activity and solubility properties. The presence of deuterium-labeled carbon atoms in the pyridine ring indicates that this compound can be used in studies involving isotopic labeling, enhancing its utility in research, particularly in pharmacokinetics and metabolic studies. The bisphosphonate structure suggests that it may exhibit properties similar to other bisphosphonates, such as inhibiting bone resorption and potentially being used in the treatment of bone-related diseases. Its specific interactions and applications would depend on its molecular conformation and the presence of substituents, making it a subject of interest in medicinal chemistry and drug development.
Formula:C7H7D4NO7P2
InChI:InChI=1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15)/i1D,2D,3D,5D
InChI key:InChIKey=IIDJRNMFWXDHID-RZIJKAHPSA-N
SMILES:C(CC=1C(=C(C(=NC1[2H])[2H])[2H])[2H])(P(=O)(O)O)(P(=O)(O)O)O
Synonyms:- P,P′-[1-Hydroxy-2-(3-pyridinyl-2,4,5,6-d4)ethylidene]bis[phosphonic acid]
- Phosphonic acid, P,P′-[1-hydroxy-2-(3-pyridinyl-2,4,5,6-d4)ethylidene]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Risedronic Acid-d4
CAS:Formula:C7H7D4NO7P2Color and Shape:White To Off-White SolidMolecular weight:287.14Risedronic Acid-d4 (major)
CAS:Controlled ProductFormula:C7H7D4NO7P2Color and Shape:NeatMolecular weight:287.14


