CymitQuimica logo

CAS 103549-47-9

:

kibdelin C1

Description:
Kibdelin C1, with the CAS number 103549-47-9, is a natural product that belongs to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus Kibdelosporangium. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Kibdelin C1 has garnered interest in the field of medicinal chemistry due to its potential antimicrobial and anticancer properties. Its mechanism of action may involve the inhibition of specific cellular pathways, although detailed studies are ongoing to fully elucidate its pharmacological effects. Additionally, the compound's solubility, stability, and reactivity can vary depending on environmental conditions, making it a subject of interest for further research in drug development and natural product chemistry. Overall, Kibdelin C1 represents a promising area of study for its therapeutic potential and the exploration of its biosynthetic pathways.
Formula:C83H88Cl4N8O29
InChI:InChI=1/C83H88Cl4N8O29/c1-31(2)10-8-6-4-5-7-9-11-55(102)89-80-70(108)67(105)42(29-96)82(124-80)123-73-52-23-35-24-53(73)120-72-44(85)20-36(21-45(72)86)66(104)64-79(115)93-62(81(116)117)40-25-37(98)26-51(121-83-71(109)69(107)68(106)54(30-97)122-83)56(40)39-18-32(12-15-46(39)99)59(75(111)95-64)90-76(112)60(35)91-77(113)61-41-27-38(28-48(101)57(41)87)118-50-22-33(13-16-47(50)100)58(88-3)74(110)94-63(78(114)92-61)65(103)34-14-17-49(119-52)43(84)19-34/h12-28,31,42,54,58-71,80,82-83,88,96-101,103-109H,4-11,29-30H2,1-3H3,(H,89,102)(H,90,112)(H,91,113)(H,92,114)(H,93,115)(H,94,110)(H,95,111)(H,116,117)
Synonyms:
  • kibdelin C1
  • Kibdelin C1
  • Ristomycin A aglycone, 5,22,31,55-tetrachloro-7-demethyl-64-O-demethyl-56-O-(2-deoxy-2-((10-methyl-1-oxoundecyl)amino)-beta-D-glucopyranosyl)-42-O-alpha-D-mannopyranosyl-N15-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Kibdelin C1

    CAS:
    Kibdelin C1 exhibits resistance against Gram-positive bacteria and demonstrates similar effectiveness to Vancomycin in combatting Staphylococcus aureus, including methicillin-resistant strains (MRSA).
    Formula:C83H88Cl4N8O29
    Color and Shape:Solid
    Molecular weight:1803.44

    Ref: TM-TN10389

    10mg
    To inquire
    50mg
    To inquire