CAS 103576-44-9

5-OCTANOYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE

Description:

5-Octanoyl-2,2-dimethyl-1,3-dioxane-4,6-dione, with the CAS number 103576-44-9, is a chemical compound characterized by its unique dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is a derivative of dioxane and includes an octanoyl group, contributing to its hydrophobic properties. The presence of two methyl groups at the 2-position enhances its steric bulk, which can influence its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The dione functional groups suggest potential reactivity, particularly in condensation reactions or as intermediates in synthetic pathways. Additionally, the compound's stability and behavior under different conditions, such as temperature and pH, would be essential for applications in chemical synthesis or formulation. Overall, 5-octanoyl-2,2-dimethyl-1,3-dioxane-4,6-dione represents a versatile structure with potential utility in various chemical contexts.

Formula: C₁₄H₂₂O₅

InChI: InChI=1/C14H22O5/c1-4-5-6-7-8-9-10(15)11-12(16)18-14(2,3)19-13(11)17/h11H,4-9H2,1-3H3

SMILES: CCCCCCCC(=O)C1C(=O)OC(C)(C)OC1=O

Synonyms:

• 2,2-dimethyl-5-(1-oxooctyl)-1,3-Dioxane-4,6-dione
• 2,2-Dimethyl-5-Octanoyl-1,3-Dioxane-4,6-Dione