
CAS 103577-41-9
:2-[[[5-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole
Description:
2-[[[5-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole, with CAS number 103577-41-9, is a chemical compound characterized by its complex structure, which includes a benzimidazole core and a pyridine ring. This compound features a thioether linkage, connecting the benzimidazole to a pyridine derivative that is further substituted with a trifluoroethoxy group. The presence of the trifluoroethoxy moiety imparts unique electronic and steric properties, enhancing its potential biological activity. The methyl group on the pyridine ring may influence its lipophilicity and solubility. This compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, where it may exhibit various biological activities, including antimicrobial or anticancer properties. Its synthesis and characterization typically involve standard organic chemistry techniques, and its stability and reactivity can be influenced by the functional groups present. As with many such compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H14F3N3OS
InChI:InChI=1S/C16H14F3N3OS/c1-10-7-20-11(6-14(10)23-9-16(17,18)19)8-24-15-21-12-4-2-3-5-13(12)22-15/h2-7H,8-9H2,1H3,(H,21,22)
InChI key:InChIKey=YVGVHRFJKMEOMW-UHFFFAOYSA-N
SMILES:S(CC1=CC(OCC(F)(F)F)=C(C)C=N1)C=2NC=3C(N2)=CC=CC3
Synonyms:- 1H-Benzimidazole, 2-[[[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-
- 2-[[[5-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.