
CAS 1035818-87-1
:1,1-Dimethylethyl 2-methyl-3-propyl-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 2-methyl-3-propyl-1-piperazinecarboxylate, identified by its CAS number 1035818-87-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The compound is characterized by the presence of a carboxylate functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the dimethyl and propyl substituents on the piperazine ring indicates that it may exhibit unique steric and electronic properties, influencing its biological activity and interactions. Typically, such compounds may be investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular structure and the arrangement of substituents, which can significantly affect the compound's behavior in different environments.
Formula:C13H26N2O2
InChI:InChI=1S/C13H26N2O2/c1-6-7-11-10(2)15(9-8-14-11)12(16)17-13(3,4)5/h10-11,14H,6-9H2,1-5H3
InChI key:InChIKey=OEBUSDBRXUSYID-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(C)C(CCC)NCC1
Synonyms:- 1-Piperazinecarboxylic acid, 2-methyl-3-propyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-methyl-3-propyl-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.