
CAS 1035818-93-9
:3-(4-Pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde
Description:
3-(4-Pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core fused with a pyridine ring. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the pyridine moiety may enhance its biological activity, making it a candidate for various pharmacological studies. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, which can be explored for therapeutic purposes. Its molecular structure suggests potential for diverse chemical modifications, allowing for the development of derivatives with tailored properties. As with many heterocycles, the compound may exhibit interesting electronic properties due to the presence of nitrogen atoms in the ring systems, influencing its reactivity and interaction with other molecules. Overall, 3-(4-Pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde represents a valuable scaffold in the field of drug discovery and development.
Formula:C12H8N4O
InChI:InChI=1S/C12H8N4O/c17-8-9-5-14-12-11(6-15-16(12)7-9)10-1-3-13-4-2-10/h1-8H
InChI key:InChIKey=HFHVOWIVNFGKOZ-UHFFFAOYSA-N
SMILES:C(=O)C1=CN2C(=C(C=N2)C=3C=CN=CC3)N=C1
Synonyms:- Pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde, 3-(4-pyridinyl)-
- 3-(4-Pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.