CymitQuimica logo

CAS 1035818-96-2

:

2-(5-Bromo-3-pyridinyl)-1H-benzimidazol-6-amine

Description:
2-(5-Bromo-3-pyridinyl)-1H-benzimidazol-6-amine is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a brominated pyridine group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both amine and halogen functional groups. The bromine atom can influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of the pyridine ring may also impart specific biological activities, as pyridine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its unique characteristics make it a subject of interest in both research and industrial applications, particularly in fields related to drug discovery and material science.
Formula:C12H9BrN4
InChI:InChI=1S/C12H9BrN4/c13-8-3-7(5-15-6-8)12-16-10-2-1-9(14)4-11(10)17-12/h1-6H,14H2,(H,16,17)
InChI key:InChIKey=JTOYHRZXGMEUQV-UHFFFAOYSA-N
SMILES:BrC1=CC(C=2NC=3C(N2)=CC(N)=CC3)=CN=C1
Synonyms:
  • 2-(5-Bromo-3-pyridinyl)-1H-benzimidazol-6-amine
  • 1H-Benzimidazol-6-amine, 2-(5-bromo-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.