CAS 103582-29-2
:1,2,3,4,6,7,8,9-octabromodibenzofuran
Description:
1,2,3,4,6,7,8,9-Octabromodibenzofuran is a polybrominated aromatic compound characterized by the presence of multiple bromine atoms attached to a dibenzofuran structure. This compound is known for its high degree of bromination, which significantly enhances its flame-retardant properties, making it useful in various applications, particularly in plastics and textiles. Its molecular structure contributes to its stability and resistance to degradation, although this also raises concerns regarding environmental persistence and bioaccumulation. The compound is typically solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. Due to its brominated nature, it can be a subject of regulatory scrutiny, particularly concerning its potential toxicity and effects on human health and ecosystems. As with many brominated compounds, there is ongoing research into its environmental impact, degradation pathways, and potential alternatives that may pose less risk.
Formula:C12Br8O
InChI:InChI=1/C12Br8O/c13-3-1-2-4(14)6(16)8(18)10(20)12(2)21-11(1)9(19)7(17)5(3)15
SMILES:c12c3c(c(c(c(c3oc2c(c(c(c1Br)Br)Br)Br)Br)Br)Br)Br
Synonyms:- Octabromodibenzofuran
- 1,2,3,4,6,7,8,9-Octabromodibenzo[B,D]Furan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.