CAS 103585-71-3
:4-Chloro-5-fluoroindolin-2-one
Description:
4-Chloro-5-fluoroindolin-2-one is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a chloro group at the 4-position and a fluoro group at the 5-position of the indole moiety, contributing to its unique chemical properties. It typically appears as a solid and is soluble in organic solvents, reflecting its hydrophobic nature. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its CAS number, 103585-71-3, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and regulatory databases. Overall, 4-Chloro-5-fluoroindolin-2-one exemplifies the complexity and versatility of halogenated indole derivatives in organic synthesis and drug discovery.
Formula:C8H5ClFNO
InChI:InChI=1/C8H5ClFNO/c9-8-4-3-7(12)11-6(4)2-1-5(8)10/h1-2H,3H2,(H,11,12)
SMILES:c1cc2c(CC(=N2)O)c(c1F)Cl
Synonyms:- 4-Chloro-5-fluoro-1,3-dihydro-2H-indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.