CAS 10359-61-2
:Butyl sec-butyl sulfide
Description:
Butyl sec-butyl sulfide, with the CAS number 10359-61-2, is an organic compound characterized by its sulfur-containing structure. It belongs to the class of thioethers, which are compounds featuring a sulfur atom bonded to two alkyl or aryl groups. This particular compound has a butyl group and a sec-butyl group, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. Butyl sec-butyl sulfide is known for its applications in organic synthesis and as an intermediate in the production of various chemicals. Its reactivity is primarily due to the presence of the sulfur atom, which can participate in nucleophilic reactions. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, butyl sec-butyl sulfide is a valuable compound in the field of organic chemistry.
Formula:C8H18S
InChI:InChI=1/C8H18S/c1-4-6-7-9-8(3)5-2/h8H,4-7H2,1-3H3
Synonyms:- 1-(butan-2-ylsulfanyl)butane
- 1-((1-Methylpropyl)thio)butane
- Sulfide, butyl sec-butyl
- Butane, 1-((1-methylpropyl)thio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.