CymitQuimica logo

CAS 1036027-56-1

:

1-[(4-Methylphenyl)sulfonyl]-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:
1-[(4-Methylphenyl)sulfonyl]-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrrolo[2,3-b]pyridine core substituted with a sulfonyl group and a trifluoromethyl group. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its biological activity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its sulfonyl moiety can also play a role in the compound's ability to form hydrogen bonds, which is crucial for its interaction with proteins or enzymes. Overall, the combination of these functional groups suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H11F3N2O2S
InChI:InChI=1S/C15H11F3N2O2S/c1-10-2-4-13(5-3-10)23(21,22)20-7-6-11-8-12(15(16,17)18)9-19-14(11)20/h2-9H,1H3
InChI key:InChIKey=RNKVQAUOKDXQIM-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1)=CC(C(F)(F)F)=CN2)C3=CC=C(C)C=C3
Synonyms:
  • 1-(4-Methylphenyl)sulfonyl-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 1-[(4-methylphenyl)sulfonyl]-5-(trifluoromethyl)-
  • 1-[(4-Methylphenyl)sulfonyl]-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.