CymitQuimica logo

CAS 1036028-17-7

:

5-Methyl-1-[(4-methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine

Description:
5-Methyl-1-[(4-methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, a sulfonyl group, and a boron-containing moiety. The presence of the 4-methylphenyl sulfonyl group enhances its potential for various chemical reactions, particularly in medicinal chemistry and organic synthesis. The boron-containing dioxaborolane unit suggests potential applications in cross-coupling reactions, such as Suzuki coupling, which is valuable in the synthesis of complex organic molecules. The compound's molecular structure indicates it may exhibit interesting electronic properties and biological activity, making it a candidate for further research in drug development or material science. Additionally, the presence of multiple functional groups allows for diverse reactivity and potential modifications, which can be explored in various chemical contexts. Overall, this compound exemplifies the intricate design often found in modern organic chemistry, particularly in the development of pharmaceuticals.
Formula:C21H25BN2O4S
InChI:InChI=1S/C21H25BN2O4S/c1-14-7-9-16(10-8-14)29(25,26)24-13-18(17-11-15(2)12-23-19(17)24)22-27-20(3,4)21(5,6)28-22/h7-13H,1-6H3
InChI key:InChIKey=VBVMZWKIPYDSON-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(=C1)B3OC(C)(C)C(C)(C)O3)=CC(C)=CN2)C4=CC=C(C)C=C4
Synonyms:
  • 5-Methyl-1-[(4-methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 5-methyl-1-[(4-methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.