CAS 103604-49-5
:6-Methoxy-5-(trifluoromethyl)-1-naphthalenecarbonitrile
Description:
6-Methoxy-5-(trifluoromethyl)-1-naphthalenecarbonitrile, with the CAS number 103604-49-5, is an organic compound characterized by its naphthalene backbone, which is substituted at the 6-position with a methoxy group and at the 5-position with a trifluoromethyl group. This compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry and agrochemical research. The methoxy group can influence the electronic properties and solubility of the compound. Overall, this substance is notable for its unique structural features, which may impart specific biological activities or chemical reactivity, making it a subject of interest in synthetic organic chemistry and related fields. Its properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or found in chemical databases.
Formula:C13H8F3NO
InChI:InChI=1S/C13H8F3NO/c1-18-11-6-5-9-8(7-17)3-2-4-10(9)12(11)13(14,15)16/h2-6H,1H3
InChI key:InChIKey=OBVHIQXSTOJOBZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(C(C#N)=CC=C2)C=CC1OC
Synonyms:- 6-Methoxy-5-trifluoromethyl-1-cyanonaphthalene
- 1-Naphthalenecarbonitrile, 6-methoxy-5-(trifluoromethyl)-
- 6-Methoxy-5-(trifluoromethyl)-1-naphthalenecarbonitrile
- 1-Cyano-6-methoxy-5-(trifluoromethyl)naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.