CAS 10361-11-2
:Nonyl gallate
Description:
Nonyl gallate, with the CAS number 10361-11-2, is an organic compound that belongs to the class of gallate esters. It is derived from gallic acid and nonyl alcohol, characterized by its long hydrophobic nonyl chain, which contributes to its surfactant properties. Nonyl gallate is primarily recognized for its antioxidant capabilities, making it valuable in various applications, particularly in the food and cosmetic industries, where it helps to prevent oxidative degradation of products. The compound is typically a pale yellow to amber liquid and is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic nature. Nonyl gallate is also noted for its stability under a range of pH conditions, which enhances its utility as a preservative. Additionally, it has been studied for its potential health benefits, including anti-inflammatory and antimicrobial properties. However, as with any chemical substance, safety assessments are essential to evaluate its environmental impact and potential toxicity.
Formula:C16H24O5
InChI:InChI=1S/C16H24O5/c1-2-3-4-5-6-7-8-9-21-16(20)12-10-13(17)15(19)14(18)11-12/h10-11,17-19H,2-9H2,1H3
InChI key:InChIKey=KSNJEADFLJNDCP-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCC)(=O)C1=CC(O)=C(O)C(O)=C1
Synonyms:- Gallic acid, nonyl ester
- Benzoic acid, 3,4,5-trihydroxy-, nonyl ester
- Nonyl gallate
- Nonyl 3,4,5-trihydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Nonyl gallate
CAS:<p>Nonyl gallate is a chemical compound that is used as an antimicrobial agent. It is a fatty acid ester of n-hexadecyl alcohol, which has been shown to exhibit potent inhibition against the bacterium genus Streptococcus and virus SV5. Nonyl gallate has also been shown to have microbicidal activity, exhibiting potent inhibition against Candida albicans, Staphylococcus epidermidis, and Pseudomonas aeruginosa. This compound exhibits chemical stability in organic solvents such as ethanol and acetone.</p>Formula:C16H24O5Purity:Min. 95%Color and Shape:PowderMolecular weight:296.36 g/mol
