CAS 10361-94-1
:Boric acid (H3BO3), zinc salt
Description:
Boric acid (H3BO3), zinc salt, commonly referred to as zinc borate, is an inorganic compound characterized by its white crystalline appearance. It is formed by the reaction of boric acid with zinc oxide or zinc salts. This compound exhibits several notable properties, including its role as a flame retardant, which makes it valuable in various industrial applications, particularly in plastics and textiles. Zinc borate also possesses antifungal and antibacterial properties, contributing to its use in wood preservation and as a biocide in certain formulations. Additionally, it is known for its low toxicity, making it a safer alternative to some other chemical agents. The compound is soluble in water, and its solubility can vary depending on the pH of the solution. In terms of safety, while it is generally considered low-risk, appropriate handling and safety measures should be observed to avoid potential irritation. Overall, zinc borate is a versatile compound with applications spanning multiple industries, including construction, agriculture, and manufacturing.
Formula:BH3O3·xZn
InChI:InChI=1S/BH3O3.Zn/c2-1(3)4;/h2-4H;
InChI key:InChIKey=OMUGFZNEOIWQOD-UHFFFAOYSA-N
SMILES:B(O)(O)O.[Zn]
Synonyms:- Zinc borate (3:2)
- Boric acid (H3BO3), zinc salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
