CAS 103613-84-9
:N-methyl-L-tyrosylglycylglycyl-L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N~5~-(diaminomethylidene)-N~2~-methyl-L-ornithyl-N-ethyl-D-leucinamide
Description:
N-methyl-L-tyrosylglycylglycyl-L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N~5~-(diaminomethylidene)-N~2~-methyl-L-ornithyl-N-ethyl-D-leucinamide, with CAS number 103613-84-9, is a complex synthetic peptide that exhibits characteristics typical of peptide compounds. It is composed of multiple amino acid residues, which contribute to its structural and functional properties. The presence of various functional groups, including amides and diaminomethylidene moieties, suggests potential biological activity, possibly as a ligand or in therapeutic applications. The specific arrangement of amino acids indicates that it may interact with biological receptors or enzymes, influencing physiological processes. Additionally, the methyl and ethyl substitutions on the ornithine residues may enhance its stability and bioavailability. Such peptides are often studied for their roles in drug development, particularly in targeting specific pathways in diseases. Overall, this compound exemplifies the complexity and diversity of peptide chemistry, with implications for medicinal chemistry and biochemistry.
Formula:C50H81N15O9
InChI:InChI=1/C50H81N15O9/c1-8-56-44(70)37(24-30(2)3)64-47(73)40(17-13-23-58-50(53)54)65(7)48(74)35(16-12-22-57-49(51)52)62-45(71)38(25-31(4)5)63-46(72)39(27-32-14-10-9-11-15-32)61-42(68)29-59-41(67)28-60-43(69)36(55-6)26-33-18-20-34(66)21-19-33/h9-11,14-15,18-21,30-31,35-40,55,66H,8,12-13,16-17,22-29H2,1-7H3,(H,56,70)(H,59,67)(H,60,69)(H,61,68)(H,62,71)(H,63,72)(H,64,73)(H4,51,52,57)(H4,53,54,58)/t35-,36-,37+,38-,39-,40-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(N-Me-Tyr¹,N-Me-Arg⁷,D-Leu-NHEt⁸)-Dynorphin A (1-8)
CAS:Highly stable dynorphin-like analgesic peptide.Formula:C50H81N15O9Molecular weight:1036.29(N-Me-Tyr1,N-Me-Arg7,D-Leu-NHEt8)-Dynorphin A (1-8)
CAS:<p>E-2078, known chemically as (N-Me-Tyr1,N-Me-Arg7,D-Leu-NHEt8)-Dynorphin A (1-8), is a stable analog of Dynorphin A (1–8) and functions as a kappa opioid</p>Formula:C50H81N15O9Color and Shape:SolidMolecular weight:1036.27(N-Me-Tyr1,N-Me-Arg7,D-Leu-NHEt 8)-Dynorphin A (1-8) trifluoroacetate salt
CAS:<p>Please enquire for more information about (N-Me-Tyr1,N-Me-Arg7,D-Leu-NHEt 8)-Dynorphin A (1-8) trifluoroacetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C50H81N15O9Purity:Min. 95%Molecular weight:1,036.27 g/mol



